Drug Information
| Drug General Information | |||||
|---|---|---|---|---|---|
| Drug ID |
D0OH5I
|
||||
| Former ID |
DNC001544
|
||||
| Drug Name |
Zydis selegiline
|
||||
| Drug Type |
Small molecular drug
|
||||
| Indication | Motor symptoms; Parkinson's disease [ICD9: 332, 335.2; ICD10:F02.3, G12.2, G20] | Investigative | [536266] | ||
| Formula |
C13H18ClN
|
||||
| Canonical SMILES |
CC(CC1=CC=CC=C1)N(C)CC#C.Cl
|
||||
| InChI |
1S/C13H17N.ClH/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13;/h1,5-9,12H,10-11H2,2-3H3;1H/t12-;/m1./s1
|
||||
| InChIKey |
IYETZZCWLLUHIJ-UTONKHPSSA-N
|
||||
| CAS Number |
CAS 14611-52-0
|
||||
| PubChem Compound ID | |||||
| PubChem Substance ID |
7847850, 8169368, 10321789, 12014185, 14822768, 15121497, 24278577, 26719766, 29293585, 46386796, 49681709, 49880109, 56463000, 57310318, 79849348, 81092850, 85273785, 92125589, 92716947, 103770887, 103914274, 104170103, 104298199, 109714021, 119525024, 119526887, 124658795, 124757527, 125164331, 126584522, 126622589, 134339938, 134340702, 134989155, 144204123, 144212163, 162037735, 163414194, 164786719, 170464993, 172080146, 172080728, 175267279, 179149238, 185979595, 187072590, 198970974, 210275063, 210280701, 226426428
|
||||
| ChEBI ID |
ChEBI:9087
|
||||
| SuperDrug ATC ID |
N04BD01
|
||||
| SuperDrug CAS ID |
cas=014611519
|
||||
| Target and Pathway | |||||
| Target(s) | Amine oxidase [flavin-containing] B | Target Info | Inhibitor | [536266] | |
| KEGG Pathway | Glycine, serine and threonine metabolism | ||||
| Arginine and proline metabolism | |||||
| Histidine metabolism | |||||
| Tyrosine metabolism | |||||
| Phenylalanine metabolism | |||||
| Tryptophan metabolism | |||||
| Drug metabolism - cytochrome P450 | |||||
| Metabolic pathways | |||||
| Serotonergic synapse | |||||
| Dopaminergic synapse | |||||
| Cocaine addiction | |||||
| Amphetamine addiction | |||||
| Alcoholism | |||||
| Pathway Interaction Database | Alpha-synuclein signaling | ||||
| References | |||||
If you find any error in data or bug in web service, please kindly report it to Dr. Tang and Dr. Mou.

